d-Camphor Details
: IUPAC Name
:Chemical Class
:CAS Registry Number
464-49-3
:Description
:Fragrance Type
camphoraceous aroma??
Physical and Chemical properties
PUBCHEM ID | 159055 |
Molecular Weight (mg/mol) | 152.238 |
Molecular Formula | C10H16O |
Hydrogen Bond Donor Count | 1 |
Hydrogen Bond Acceptor Count | 2 |
Rotatable Bond Count | 6 |
IUPAC Name | |
Canonical SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2 |
PUBCHEM IUPAC INCHIKEY | DSSYKIVIOFKYAU-XCBNKYQSSA-N |
Solubility Level | 3 |
Vapour Pressure | -0.342 |
Absorption and Metabolism information
XLOGP3 AA | NA |
CACTVS TPSA | 37.29 |
BBB Level | 1 |
Absorption Level | 0 |
EXT PPB#Prediction | 1 |
AlogP98 | 2.075 |
EXT CYP2D6#Prediction | 0 |
Toxicological Information
Mouse Female FDA | Multi-Carcinogen |
Mouse Male FDA | Multi-Carcinogen |
Rat Female FDA | Single-Carcinogen |
Rat Male FDA | Multi-Carcinogen |
Ames Prediction | Non-Mutagen |
Developmental / Reproductive Toxicity | Toxic |
Rat Oral LD50 | 1.69097 |
Ocular Irritancy | Mild |
Hepatotoxic#Prediction | 0 |
Effected Human Genes | NA |
Ecological Information
Aerobic Biodegradability Prediction | Degradable |
Hazard(s) Identification
Physical hazards | not classified |
Health hazards | Moderate |
Environmental hazards | not classified |
About Table Headings
Compound Biological Activity
Serial No. | Cas No | Gene Symbol | Organism | Interaction |
Interaction Actions | PubMed Id |
---|
1 |
464-49-3 |
|
|
|
|
|
2 |
464-49-3 |
|
|
|
|
|
3 |
464-49-3 |
|
|
|
|
|
4 |
464-49-3 |
|
|
|
|
|
5 |
464-49-3 |
|
|
|
|
|
Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
---|
1 | | |
|
464-49-3 |
d-Camphor |