PUBCHEM ID | 61041 |
Molecular Weight (mg/mol) | 150.222 |
Molecular Formula | C10H14O |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 2 |
Rotatable Bond Count | 6 |
IUPAC Name | 2,6,6-Trimethylcyclohexa-1,3-dienylmethanal |
Canonical SMILES | C/C1=C(C=O)/C(C)(C)C/C=C1 |
PUBCHEM IUPAC INCHIKEY | SGAWOGXMMPSZPB-UHFFFAOYSA-N |
Solubility Level | 3 |
Vapour Pressure | -0.817 |
XLOGP3 AA | NA |
CACTVS TPSA | 26.3 |
BBB Level | 1 |
Absorption Level | 0 |
EXT PPB#Prediction | 1 |
AlogP98 | 2.364 |
EXT CYP2D6#Prediction | 0 |
Mouse Female FDA | Multi-Carcinogen |
Mouse Male FDA | Multi-Carcinogen |
Rat Female FDA | Multi-Carcinogen |
Rat Male FDA | Single-Carcinogen |
Ames Prediction | Non-Mutagen |
Developmental / Reproductive Toxicity | Toxic |
Rat Oral LD50 | 0.84727 |
Ocular Irritancy | Severe |
Hepatotoxic#Prediction | 0 |
Effected Human Genes | NA |
Aerobic Biodegradability Prediction | Degradable |
Physical hazards | not classified |
Health hazards | Moderate |
Environmental hazards | not classified |
Serial No. | Cas No | Gene Symbol | Organism | Interaction | Interaction Actions | PubMed Id |
---|---|---|---|---|---|---|
1 | 116-26-7 | GCLC | [safranal co-treated with Rotenone] affects the expression of GCLC | affects^cotreatment|affects^expression | 28145852 | |
2 | 116-26-7 | HMOX1 | [safranal co-treated with Rotenone] affects the expression of HMOX1 | affects^cotreatment|affects^expression | 28145852 | |
3 | 116-26-7 | KEAP1 | [safranal co-treated with Rotenone] affects the expression of KEAP1 | affects^cotreatment|affects^expression | 28145852 | |
4 | 116-26-7 | NFE2L2 | [safranal co-treated with Rotenone] affects the localization of NFE2L2 protein | affects^cotreatment|affects^localization | 28145852 | |
5 | 116-26-7 | NQO1 | [safranal co-treated with Rotenone] affects the expression of NQO1 | affects^cotreatment|affects^expression | 28145852 |
Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
---|---|---|---|---|---|
1 | 116-26-7 | Dehydro-beta-cyclocitral |