PUBCHEM ID | 73174 |
Molecular Weight (mg/mol) | 230.30222 |
Molecular Formula | C15H18O2 |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 2 |
Rotatable Bond Count | 0 |
IUPAC Name | (3aS,6aR,9aR,9bS)-3,6,9-trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
Canonical SMILES | C=C2CCC1C(=C)C(=O)OC1C3C(=C)CCC23 |
PUBCHEM IUPAC INCHIKEY | NETSQGRTUNRXEO-XUXIUFHCSA-N |
Solubility Level | |
Vapour Pressure | -3.595 |
XLOGP3 AA | |
CACTVS TPSA | 26.3 A^2 |
BBB Level | |
Absorption Level | |
EXT PPB#Prediction | |
AlogP98 | |
EXT CYP2D6#Prediction |
Mouse Female FDA | |
Mouse Male FDA | |
Rat Female FDA | |
Rat Male FDA | |
Ames Prediction | |
Developmental / Reproductive Toxicity | |
Rat Oral LD50 | |
Ocular Irritancy | |
Hepatotoxic#Prediction | |
Effected Human Genes |
Aerobic Biodegradability Prediction |
Physical hazards | not classified |
Health hazards | |
Environmental hazards | not classified |
Serial No. | Cas No | Gene Symbol | Organism | Interaction | Interaction Actions | PubMed Id |
---|---|---|---|---|---|---|
1 | 477-43-0 | HMOX1 | Mus musculus | dehydrocostus lactone results in increased expression of HMOX1 protein | increases^expression | 23942037 |
2 | 477-43-0 | HMOX1 | Mus musculus | dehydrocostus lactone results in increased expression of HMOX1 protein | increases^expression | 23942037 |
3 | 477-43-0 | NOS2 | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of NOS2 protein] | decreases^reaction|increases^expression | 26970604 |
4 | 477-43-0 | NOS2 | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of NOS2 protein] | decreases^reaction|increases^expression | 26970604 |
5 | 477-43-0 | PTGS2 | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of PTGS2 protein] | decreases^reaction|increases^expression | 26970604 |
6 | 477-43-0 | PTGS2 | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of PTGS2 protein] | decreases^reaction|increases^expression | 26970604 |
7 | 477-43-0 | TNF | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of TNF protein] | decreases^reaction|increases^expression | 26970604 |
8 | 477-43-0 | TNF | Mus musculus | dehydrocostus lactone inhibits the reaction [Ethanol results in increased expression of TNF protein] | decreases^reaction|increases^expression | 26970604 |
Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
---|
Serial No. | Plant Name | Variety Name | Essential Oil | Compound Percentage |
---|---|---|---|---|
1 | Kuth | Saussurea lappa essential oil |