Dihydrocuminyl alcohol Details
: IUPAC Name
p-Mentha-1,8-dien-7-ol
:Chemical Class
:CAS Registry Number
:Description
:Fragrance Type
minty
Physical and Chemical properties
| PUBCHEM ID | 56924101 |
| Molecular Weight (mg/mol) | 152.238 |
| Molecular Formula | C10H16O |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 9 |
| IUPAC Name | p-Mentha-1,8-dien-7-ol |
| Canonical SMILES | CC(C)/C1=C/C[C@H](CO)/C=C1 |
| PUBCHEM IUPAC INCHIKEY | PGXNVJUNGMMOAV-SECBINFHSA-N |
| Solubility Level | 4 |
| Vapour Pressure | -1.899 |
Absorption and Metabolism information
| XLOGP3 AA | NA |
| CACTVS TPSA | 52.6 |
| BBB Level | 1 |
| Absorption Level | 0 |
| EXT PPB#Prediction | 1 |
| AlogP98 | 2.095 |
| EXT CYP2D6#Prediction | 0 |
Toxicological Information
| Mouse Female FDA | Multi-Carcinogen |
| Mouse Male FDA | Multi-Carcinogen |
| Rat Female FDA | Multi-Carcinogen |
| Rat Male FDA | Multi-Carcinogen |
| Ames Prediction | Non-Mutagen |
| Developmental / Reproductive Toxicity | Non-Toxic |
| Rat Oral LD50 | 1.05341 |
| Ocular Irritancy | Severe |
| Hepatotoxic#Prediction | 0 |
| Effected Human Genes | NA |
Ecological Information
| Aerobic Biodegradability Prediction | Degradable |
Hazard(s) Identification
| Physical hazards | not classified |
| Health hazards | Moderate |
| Environmental hazards | not classified |
About Table Headings
Compound Biological Activity
| Serial No. | Cas No | Gene Symbol | Organism | Interaction |
Interaction Actions | PubMed Id |
|---|
| 1 |
|
|
|
|
|
|
| Serial No. | Activity Name | Details | References (PubMed) | Other details EPA (U.S) | Clinical Trials (U.S. NIH) |
|---|
| 1 | | |
|
|
Dihydrocuminyl alcohol |